About 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole
4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole (PubChem CID 11530232) has the molecular formula C18H19N3O4
and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole |
| PubChem CID | 11530232 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole |
| SMILES | COc1ccc(-c2cn(-c3cc(OC)c(OC)c(OC)c3)nn2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-22-14-7-5-12(6-8-14)15-11-21(20-19-15)13-9-16(23-2)18(25-4)17(10-13)24-3/h5-11H,1-4H3 |
| InChIKey | HMMUPSGZXVSOAC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole?
The IUPAC name of 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole (CID 11530232) is 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole?
The canonical SMILES for 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole is COc1ccc(-c2cn(-c3cc(OC)c(OC)c(OC)c3)nn2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole?
The InChIKey is HMMUPSGZXVSOAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4/c1-22-14-7-5-12(6-8-14)15-11-21(20-19-15)13-9-16(23-2)18(25-4)17(10-13)24-3/h5-11H,1-4H3.
What are the key properties of 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole?
4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole has a molecular weight of 341.37 g/mol, XLogP of 2.97, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole is sourced from PubChem (CID 11530232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).