C20H24O5 — CID 11530288
(1R,2S,3R,4R,6R)-4-(2-benzylphenoxy)-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 11530288) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-(2-benzylphenoxy)-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-(2-benzylphenoxy)-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11530288 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-(2-benzylphenoxy)-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | OC[C@H]1C[C@@H](Oc2ccccc2Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24O5/c21-12-15-11-17(19(23)20(24)18(15)22)25-16-9-5-4-8-14(16)10-13-6-2-1-3-7-13/h1-9,15,17-24H,10-12H2/t15-,17-,18-,19+,20+/m1/s1 |
| InChIKey | DWXDHZYEUYQCQK-XLSIIYIISA-N |
| XLogP | 1.12 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |