C21H21NO4 — CID 11530420
ethyl (2S,4S)-5-oxo-2,4-diphenyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11530420) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is ethyl (2S,4S)-5-oxo-2,4-diphenyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | ethyl (2S,4S)-5-oxo-2,4-diphenyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11530420 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | ethyl (2S,4S)-5-oxo-2,4-diphenyl-4-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC[C@]1(c2ccccc2)C(=O)O[C@@H](c2ccccc2)N1C(=O)OCC |
| InChI | InChI=1S/C21H21NO4/c1-3-15-21(17-13-9-6-10-14-17)19(23)26-18(16-11-7-5-8-12-16)22(21)20(24)25-4-2/h3,5-14,18H,1,4,15H2,2H3/t18-,21-/m0/s1 |
| InChIKey | DHNKQYVEJXGHPP-RXVVDRJESA-N |
| XLogP | 4.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|