C15H24BrN3O — CID 115304310
(4-bromo-1-propan-2-ylpyrrol-2-yl)-[4-methyl-4-(methylamino)piperidin-1-yl]methanone (PubChem CID 115304310) has the molecular formula C15H24BrN3O and a molecular weight of 342.28 g/mol. Its IUPAC name is (4-bromo-1-propan-2-ylpyrrol-2-yl)-[4-methyl-4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (4-bromo-1-propan-2-ylpyrrol-2-yl)-[4-methyl-4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 115304310 |
| Molecular Formula | C15H24BrN3O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (4-bromo-1-propan-2-ylpyrrol-2-yl)-[4-methyl-4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1(C)CCN(C(=O)c2cc(Br)cn2C(C)C)CC1 |
| InChI | InChI=1S/C15H24BrN3O/c1-11(2)19-10-12(16)9-13(19)14(20)18-7-5-15(3,17-4)6-8-18/h9-11,17H,5-8H2,1-4H3 |
| InChIKey | RJJHDEJIRNTMJC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |