C14H21FN2O2S — CID 115304816
1-[(4-fluorophenyl)methylsulfonyl]-N,4-dimethylpiperidin-4-amine (PubChem CID 115304816) has the molecular formula C14H21FN2O2S and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methylsulfonyl]-N,4-dimethylpiperidin-4-amine.
| Compound Name | 1-[(4-fluorophenyl)methylsulfonyl]-N,4-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 115304816 |
| Molecular Formula | C14H21FN2O2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methylsulfonyl]-N,4-dimethylpiperidin-4-amine |
| SMILES | CNC1(C)CCN(S(=O)(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H21FN2O2S/c1-14(16-2)7-9-17(10-8-14)20(18,19)11-12-3-5-13(15)6-4-12/h3-6,16H,7-11H2,1-2H3 |
| InChIKey | LZOOLHQNQUKLSZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |