C25H44O — CID 11530594
(1S,2R,5R,6R,9R,14Z)-6-methyl-5-[(2R)-6-methylheptan-2-yl]tricyclo[7.7.0.02,6]hexadec-14-en-1-ol (PubChem CID 11530594) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is (1S,2R,5R,6R,9R,14Z)-6-methyl-5-[(2R)-6-methylheptan-2-yl]tricyclo[7.7.0.02,6]hexadec-14-en-1-ol.
| Compound Name | (1S,2R,5R,6R,9R,14Z)-6-methyl-5-[(2R)-6-methylheptan-2-yl]tricyclo[7.7.0.02,6]hexadec-14-en-1-ol |
|---|---|
| PubChem CID | 11530594 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | (1S,2R,5R,6R,9R,14Z)-6-methyl-5-[(2R)-6-methylheptan-2-yl]tricyclo[7.7.0.02,6]hexadec-14-en-1-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1CCCC/C=C\C[C@]12O |
| InChI | InChI=1S/C25H44O/c1-19(2)11-10-12-20(3)22-14-15-23-24(22,4)18-16-21-13-8-6-5-7-9-17-25(21,23)26/h7,9,19-23,26H,5-6,8,10-18H2,1-4H3/b9-7-/t20-,21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | KEKCQOBZRWSABE-FBHAMRBBSA-N |
| XLogP | 7.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|