C7H15F3N2O2S — CID 115306065
N-(2-amino-2-ethylbutyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 115306065) has the molecular formula C7H15F3N2O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 115306065 |
| Molecular Formula | C7H15F3N2O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O2S/c1-3-6(11,4-2)5-12-15(13,14)7(8,9)10/h12H,3-5,11H2,1-2H3 |
| InChIKey | RNDPXHUWQFTJQB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |