C13H18N2OS — CID 115306386
2-(2-amino-2-ethylbutyl)-1,2-benzothiazol-3-one (PubChem CID 115306386) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(2-amino-2-ethylbutyl)-1,2-benzothiazol-3-one.
| Compound Name | 2-(2-amino-2-ethylbutyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 115306386 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(2-amino-2-ethylbutyl)-1,2-benzothiazol-3-one |
| SMILES | CCC(N)(CC)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C13H18N2OS/c1-3-13(14,4-2)9-15-12(16)10-7-5-6-8-11(10)17-15/h5-8H,3-4,9,14H2,1-2H3 |
| InChIKey | GHASEUGXTWSFSK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |