C12H13F5N2 — CID 115308124
2-cyclopropyl-2-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine (PubChem CID 115308124) has the molecular formula C12H13F5N2 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-cyclopropyl-2-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine.
| Compound Name | 2-cyclopropyl-2-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115308124 |
| Molecular Formula | C12H13F5N2 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-cyclopropyl-2-N-(2,3,4,5,6-pentafluorophenyl)propane-1,2-diamine |
| SMILES | CC(CN)(Nc1c(F)c(F)c(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C12H13F5N2/c1-12(4-18,5-2-3-5)19-11-9(16)7(14)6(13)8(15)10(11)17/h5,19H,2-4,18H2,1H3 |
| InChIKey | PGLPAOBNYPFDCI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|