C19H16F3N3O2 — CID 11530902
N-[3-methoxy-5-(trifluoromethyl)phenyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-11-carboxamide (PubChem CID 11530902) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is N-[3-methoxy-5-(trifluoromethyl)phenyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-11-carboxamide.
| Compound Name | N-[3-methoxy-5-(trifluoromethyl)phenyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 11530902 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[3-methoxy-5-(trifluoromethyl)phenyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-11-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCc3cccc4ncn2c34)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3O2/c1-27-14-8-12(19(20,21)22)7-13(9-14)24-18(26)16-6-5-11-3-2-4-15-17(11)25(16)10-23-15/h2-4,7-10,16H,5-6H2,1H3,(H,24,26) |
| InChIKey | CECGTPSMLOQWAG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |