C12H19IN4 — CID 115309628
1-cyclohexyl-N-(5-iodopyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 115309628) has the molecular formula C12H19IN4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-cyclohexyl-N-(5-iodopyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N-(5-iodopyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115309628 |
| Molecular Formula | C12H19IN4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-cyclohexyl-N-(5-iodopyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | NCC(Nc1ncncc1I)C1CCCCC1 |
| InChI | InChI=1S/C12H19IN4/c13-10-7-15-8-16-12(10)17-11(6-14)9-4-2-1-3-5-9/h7-9,11H,1-6,14H2,(H,15,16,17) |
| InChIKey | SOOFHNCHGVHYLI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|