About 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide
2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide (PubChem CID 11531008) has the molecular formula C17H20N2O6S
and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide.
Molecular Properties
| Compound Name | 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide |
| PubChem CID | 11531008 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide |
| SMILES | O=C(CN(CC(O)CO)S(=O)(=O)c1ccc(-c2ccccc2)cc1)NO |
| InChI | InChI=1S/C17H20N2O6S/c20-12-15(21)10-19(11-17(22)18-23)26(24,25)16-8-6-14(7-9-16)13-4-2-1-3-5-13/h1-9,15,20-21,23H,10-12H2,(H,18,22) |
| InChIKey | OEHVKBKRRIUTOR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide?
The IUPAC name of 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide (CID 11531008) is 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide.
What is the SMILES notation for 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide?
The canonical SMILES for 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide is O=C(CN(CC(O)CO)S(=O)(=O)c1ccc(-c2ccccc2)cc1)NO.
What is the InChIKey of 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide?
The InChIKey is OEHVKBKRRIUTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O6S/c20-12-15(21)10-19(11-17(22)18-23)26(24,25)16-8-6-14(7-9-16)13-4-2-1-3-5-13/h1-9,15,20-21,23H,10-12H2,(H,18,22).
What are the key properties of 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide?
2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide has a molecular weight of 380.42 g/mol, XLogP of 0.20, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dihydroxypropyl-(4-phenylphenyl)sulfonylamino]-N-hydroxyacetamide is sourced from PubChem (CID 11531008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).