C18H26N2O2Se — CID 11531029
2-(N-acetylanilino)-N-cyclohexyl-3-methylselanylpropanamide (PubChem CID 11531029) has the molecular formula C18H26N2O2Se and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-(N-acetylanilino)-N-cyclohexyl-3-methylselanylpropanamide.
| Compound Name | 2-(N-acetylanilino)-N-cyclohexyl-3-methylselanylpropanamide |
|---|---|
| PubChem CID | 11531029 |
| Molecular Formula | C18H26N2O2Se |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(N-acetylanilino)-N-cyclohexyl-3-methylselanylpropanamide |
| SMILES | C[Se]CC(C(=O)NC1CCCCC1)N(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O2Se/c1-14(21)20(16-11-7-4-8-12-16)17(13-23-2)18(22)19-15-9-5-3-6-10-15/h4,7-8,11-12,15,17H,3,5-6,9-10,13H2,1-2H3,(H,19,22) |
| InChIKey | PAIZOYVQZUUNKC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|