C14H19N3O2 — CID 115310335
2-(1-amino-2,4-dimethylpentan-2-yl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 115310335) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(1-amino-2,4-dimethylpentan-2-yl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(1-amino-2,4-dimethylpentan-2-yl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 115310335 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(1-amino-2,4-dimethylpentan-2-yl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | CC(C)CC(C)(CN)N1C(=O)c2ccncc2C1=O |
| InChI | InChI=1S/C14H19N3O2/c1-9(2)6-14(3,8-15)17-12(18)10-4-5-16-7-11(10)13(17)19/h4-5,7,9H,6,8,15H2,1-3H3 |
| InChIKey | CQSWQTDLRBCJBX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|