About N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide
N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide (PubChem CID 115310604) has the molecular formula C7H16F2N2O2S
and a molecular weight of 230.28 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide |
| PubChem CID | 115310604 |
| Molecular Formula | C7H16F2N2O2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide |
| SMILES | CC(C)C(C)(CN)NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H16F2N2O2S/c1-5(2)7(3,4-10)11-14(12,13)6(8)9/h5-6,11H,4,10H2,1-3H3 |
| InChIKey | XVRFVKZPDRFGLF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide?
The IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide (CID 115310604) is N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide.
What is the SMILES notation for N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide?
The canonical SMILES for N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide is CC(C)C(C)(CN)NS(=O)(=O)C(F)F.
What is the InChIKey of N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide?
The InChIKey is XVRFVKZPDRFGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16F2N2O2S/c1-5(2)7(3,4-10)11-14(12,13)6(8)9/h5-6,11H,4,10H2,1-3H3.
What are the key properties of N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide?
N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide has a molecular weight of 230.28 g/mol, XLogP of 0.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,3-dimethylbutan-2-yl)-1,1-difluoromethanesulfonamide is sourced from PubChem (CID 115310604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).