About 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine
2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine (PubChem CID 115311005) has the molecular formula C11H17ClFN3
and a molecular weight of 245.73 g/mol. Its IUPAC name is 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine |
| PubChem CID | 115311005 |
| Molecular Formula | C11H17ClFN3 |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine |
| SMILES | CC(C)C(C)(CN)Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C11H17ClFN3/c1-7(2)11(3,6-14)16-10-9(13)4-8(12)5-15-10/h4-5,7H,6,14H2,1-3H3,(H,15,16) |
| InChIKey | WLQHUEXXCGOCLP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine?
The IUPAC name of 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine (CID 115311005) is 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine.
What is the SMILES notation for 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine?
The canonical SMILES for 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine is CC(C)C(C)(CN)Nc1ncc(Cl)cc1F.
What is the InChIKey of 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine?
The InChIKey is WLQHUEXXCGOCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClFN3/c1-7(2)11(3,6-14)16-10-9(13)4-8(12)5-15-10/h4-5,7H,6,14H2,1-3H3,(H,15,16).
What are the key properties of 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine?
2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine has a molecular weight of 245.73 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(5-chloro-3-fluoro-2-pyridinyl)-2,3-dimethylbutane-1,2-diamine is sourced from PubChem (CID 115311005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).