C19H27N7O2 — CID 11531116
2-[2-[3-[4-(aminomethyl)-2-[2-(diaminomethylideneamino)ethoxy]phenyl]phenoxy]ethyl]guanidine (PubChem CID 11531116) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[2-[3-[4-(aminomethyl)-2-[2-(diaminomethylideneamino)ethoxy]phenyl]phenoxy]ethyl]guanidine.
| Compound Name | 2-[2-[3-[4-(aminomethyl)-2-[2-(diaminomethylideneamino)ethoxy]phenyl]phenoxy]ethyl]guanidine |
|---|---|
| PubChem CID | 11531116 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-[2-[3-[4-(aminomethyl)-2-[2-(diaminomethylideneamino)ethoxy]phenyl]phenoxy]ethyl]guanidine |
| SMILES | NCc1ccc(-c2cccc(OCCN=C(N)N)c2)c(OCCN=C(N)N)c1 |
| InChI | InChI=1S/C19H27N7O2/c20-12-13-4-5-16(17(10-13)28-9-7-26-19(23)24)14-2-1-3-15(11-14)27-8-6-25-18(21)22/h1-5,10-11H,6-9,12,20H2,(H4,21,22,25)(H4,23,24,26) |
| InChIKey | BLSUNKYDZPXGTC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 173.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|