C21H27N3O2S — CID 11531121
(2S)-3-phenyl-2-[[2-[1-(thiophen-3-ylmethyl)piperidin-4-yl]acetyl]amino]propanamide (PubChem CID 11531121) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[2-[1-(thiophen-3-ylmethyl)piperidin-4-yl]acetyl]amino]propanamide.
| Compound Name | (2S)-3-phenyl-2-[[2-[1-(thiophen-3-ylmethyl)piperidin-4-yl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 11531121 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2S)-3-phenyl-2-[[2-[1-(thiophen-3-ylmethyl)piperidin-4-yl]acetyl]amino]propanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)CC1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C21H27N3O2S/c22-21(26)19(12-16-4-2-1-3-5-16)23-20(25)13-17-6-9-24(10-7-17)14-18-8-11-27-15-18/h1-5,8,11,15,17,19H,6-7,9-10,12-14H2,(H2,22,26)(H,23,25)/t19-/m0/s1 |
| InChIKey | QCEAEWGLBVTKKX-IBGZPJMESA-N |
| XLogP | 2.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |