C23H33NO4 — CID 11531170
2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-hydroxypropanoic acid (PubChem CID 11531170) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 11531170 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC(CO)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H33NO4/c1-16(11-12-19-18(3)10-7-13-23(19,4)5)8-6-9-17(2)14-21(26)24-20(15-25)22(27)28/h6,8-9,11-12,14,20,25H,7,10,13,15H2,1-5H3,(H,24,26)(H,27,28)/b9-6+,12-11+,16-8+,17-14+ |
| InChIKey | LMAARKZBQFFVIV-VTLMDCEISA-N |
| XLogP | 4.08 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|