C13H17F3N2 — CID 115312692
[1-(2,2,2-trifluoro-1-phenylethyl)pyrrolidin-2-yl]methanamine (PubChem CID 115312692) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is [1-(2,2,2-trifluoro-1-phenylethyl)pyrrolidin-2-yl]methanamine.
| Compound Name | [1-(2,2,2-trifluoro-1-phenylethyl)pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115312692 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [1-(2,2,2-trifluoro-1-phenylethyl)pyrrolidin-2-yl]methanamine |
| SMILES | NCC1CCCN1C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H17F3N2/c14-13(15,16)12(10-5-2-1-3-6-10)18-8-4-7-11(18)9-17/h1-3,5-6,11-12H,4,7-9,17H2 |
| InChIKey | UUQYANBLYXGLSZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |