About 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine
2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine (PubChem CID 115313394) has the molecular formula C12H16N4S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine.
Molecular Properties
| Compound Name | 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine |
| PubChem CID | 115313394 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine |
| SMILES | CC1CC(N)CCN1c1ncnc2sccc12 |
| InChI | InChI=1S/C12H16N4S/c1-8-6-9(13)2-4-16(8)11-10-3-5-17-12(10)15-7-14-11/h3,5,7-9H,2,4,6,13H2,1H3 |
| InChIKey | BBAUGFYMOQXMFG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine?
The IUPAC name of 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine (CID 115313394) is 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine.
What is the SMILES notation for 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine?
The canonical SMILES for 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine is CC1CC(N)CCN1c1ncnc2sccc12.
What is the InChIKey of 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine?
The InChIKey is BBAUGFYMOQXMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4S/c1-8-6-9(13)2-4-16(8)11-10-3-5-17-12(10)15-7-14-11/h3,5,7-9H,2,4,6,13H2,1H3.
What are the key properties of 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine?
2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine has a molecular weight of 248.35 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-amine is sourced from PubChem (CID 115313394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).