About 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane
3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 115314620) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane.
Molecular Properties
| Compound Name | 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane |
| PubChem CID | 115314620 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | c1cc(N2CCC3CCC(C2)N3)ccn1 |
| InChI | InChI=1S/C12H17N3/c1-2-11-9-15(8-5-10(1)14-11)12-3-6-13-7-4-12/h3-4,6-7,10-11,14H,1-2,5,8-9H2 |
| InChIKey | KESGPHYXCUTJIZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane?
The IUPAC name of 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane (CID 115314620) is 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane.
What is the SMILES notation for 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane?
The canonical SMILES for 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane is c1cc(N2CCC3CCC(C2)N3)ccn1.
What is the InChIKey of 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane?
The InChIKey is KESGPHYXCUTJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-2-11-9-15(8-5-10(1)14-11)12-3-6-13-7-4-12/h3-4,6-7,10-11,14H,1-2,5,8-9H2.
What are the key properties of 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane?
3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane has a molecular weight of 203.29 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-yl-3,9-diazabicyclo[4.2.1]nonane is sourced from PubChem (CID 115314620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).