C21H20F2N2O4 — CID 11531466
[(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-methoxyacetate (PubChem CID 11531466) has the molecular formula C21H20F2N2O4 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-methoxyacetate.
| Compound Name | [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 11531466 |
| Molecular Formula | C21H20F2N2O4 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@@H]1[C@@H](c2ccccc2)Oc2c(ccn3c(C)c(C)nc23)C1(F)F |
| InChI | InChI=1S/C21H20F2N2O4/c1-12-13(2)25-10-9-15-18(20(25)24-12)29-17(14-7-5-4-6-8-14)19(21(15,22)23)28-16(26)11-27-3/h4-10,17,19H,11H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | QHBVNPOGEJRCBI-IEBWSBKVSA-N |
| XLogP | 3.73 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |