C14H22N2O3 — CID 115314817
2-[1-[2-(1-aminoethyl)morpholin-4-yl]ethyl]benzene-1,4-diol (PubChem CID 115314817) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[1-[2-(1-aminoethyl)morpholin-4-yl]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[2-(1-aminoethyl)morpholin-4-yl]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 115314817 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[1-[2-(1-aminoethyl)morpholin-4-yl]ethyl]benzene-1,4-diol |
| SMILES | CC(N)C1CN(C(C)c2cc(O)ccc2O)CCO1 |
| InChI | InChI=1S/C14H22N2O3/c1-9(15)14-8-16(5-6-19-14)10(2)12-7-11(17)3-4-13(12)18/h3-4,7,9-10,14,17-18H,5-6,8,15H2,1-2H3 |
| InChIKey | AGPXSIUHBYFBEG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|