About N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine
N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine (PubChem CID 11531518) has the molecular formula C21H23Cl2N3O
and a molecular weight of 404.34 g/mol. Its IUPAC name is N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine |
| PubChem CID | 11531518 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine |
| SMILES | CN(CCCCOc1ccn(-c2ccc(Cl)c(Cl)c2)n1)Cc1ccccc1 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-25(16-17-7-3-2-4-8-17)12-5-6-14-27-21-11-13-26(24-21)18-9-10-19(22)20(23)15-18/h2-4,7-11,13,15H,5-6,12,14,16H2,1H3 |
| InChIKey | PMTPMNLAVJRCSN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine?
The IUPAC name of N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine (CID 11531518) is N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine.
What is the SMILES notation for N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine?
The canonical SMILES for N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine is CN(CCCCOc1ccn(-c2ccc(Cl)c(Cl)c2)n1)Cc1ccccc1.
What is the InChIKey of N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine?
The InChIKey is PMTPMNLAVJRCSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N3O/c1-25(16-17-7-3-2-4-8-17)12-5-6-14-27-21-11-13-26(24-21)18-9-10-19(22)20(23)15-18/h2-4,7-11,13,15H,5-6,12,14,16H2,1H3.
What are the key properties of N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine?
N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine has a molecular weight of 404.34 g/mol, XLogP of 5.47, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[1-(3,4-dichlorophenyl)pyrazol-3-yl]oxy-N-methylbutan-1-amine is sourced from PubChem (CID 11531518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).