About 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine
2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine (PubChem CID 11531519) has the molecular formula C19H18F6N2O
and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine.
Molecular Properties
| Compound Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine |
| PubChem CID | 11531519 |
| Molecular Formula | C19H18F6N2O |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine |
| SMILES | FC(F)(F)c1cc(COC2CCNCC2c2ccccn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F6N2O/c20-18(21,22)13-7-12(8-14(9-13)19(23,24)25)11-28-17-4-6-26-10-15(17)16-3-1-2-5-27-16/h1-3,5,7-9,15,17,26H,4,6,10-11H2 |
| InChIKey | BTDDHSGUNRHHJZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine?
The IUPAC name of 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine (CID 11531519) is 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine.
What is the SMILES notation for 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine?
The canonical SMILES for 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine is FC(F)(F)c1cc(COC2CCNCC2c2ccccn2)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine?
The InChIKey is BTDDHSGUNRHHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F6N2O/c20-18(21,22)13-7-12(8-14(9-13)19(23,24)25)11-28-17-4-6-26-10-15(17)16-3-1-2-5-27-16/h1-3,5,7-9,15,17,26H,4,6,10-11H2.
What are the key properties of 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine?
2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine has a molecular weight of 404.35 g/mol, XLogP of 4.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]piperidin-3-yl]pyridine is sourced from PubChem (CID 11531519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).