C12H20N2O — CID 115316381
cyclopent-3-en-1-yl-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 115316381) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 115316381 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | cyclopent-3-en-1-yl-[2-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNCC1CCCN1C(=O)C1CC=CC1 |
| InChI | InChI=1S/C12H20N2O/c1-13-9-11-7-4-8-14(11)12(15)10-5-2-3-6-10/h2-3,10-11,13H,4-9H2,1H3 |
| InChIKey | SZGKZWNIPQRTQZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|