C12H23N3O — CID 115316412
N-cyclopentyl-2-(methylaminomethyl)pyrrolidine-1-carboxamide (PubChem CID 115316412) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-cyclopentyl-2-(methylaminomethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-cyclopentyl-2-(methylaminomethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 115316412 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-cyclopentyl-2-(methylaminomethyl)pyrrolidine-1-carboxamide |
| SMILES | CNCC1CCCN1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H23N3O/c1-13-9-11-7-4-8-15(11)12(16)14-10-5-2-3-6-10/h10-11,13H,2-9H2,1H3,(H,14,16) |
| InChIKey | MPPQFGZLPOAYSF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |