About (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide
(E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 11531647) has the molecular formula C24H18N4O3
and a molecular weight of 410.43 g/mol. Its IUPAC name is (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide |
| PubChem CID | 11531647 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Nc1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H18N4O3/c29-24(16-13-18-11-14-21(15-12-18)28(30)31)25-23-17-22(19-7-3-1-4-8-19)26-27(23)20-9-5-2-6-10-20/h1-17H,(H,25,29)/b16-13+ |
| InChIKey | RXGKEAWLRDYIJZ-DTQAZKPQSA-N |
| XLogP | 5.10 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide?
The IUPAC name of (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide (CID 11531647) is (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide.
What is the SMILES notation for (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide?
The canonical SMILES for (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide is O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Nc1cc(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide?
The InChIKey is RXGKEAWLRDYIJZ-DTQAZKPQSA-N. The full InChI is InChI=1S/C24H18N4O3/c29-24(16-13-18-11-14-21(15-12-18)28(30)31)25-23-17-22(19-7-3-1-4-8-19)26-27(23)20-9-5-2-6-10-20/h1-17H,(H,25,29)/b16-13+.
What are the key properties of (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide?
(E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide has a molecular weight of 410.43 g/mol, XLogP of 5.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(1,3-diphenylpyrazol-5-yl)-3-(4-nitrophenyl)prop-2-enamide is sourced from PubChem (CID 11531647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).