C21H20F6N2 — CID 11531729
(1S,2R,5S)-5-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 11531729) has the molecular formula C21H20F6N2 and a molecular weight of 414.39 g/mol. Its IUPAC name is (1S,2R,5S)-5-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-5-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 11531729 |
| Molecular Formula | C21H20F6N2 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (1S,2R,5S)-5-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3ccc(C(F)(F)F)cc3C2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H20F6N2/c22-17-8-19(24)18(23)7-16(17)15-4-3-14(6-20(15)28)29-9-11-1-2-13(21(25,26)27)5-12(11)10-29/h1-2,5,7-8,14-15,20H,3-4,6,9-10,28H2/t14-,15+,20-/m0/s1 |
| InChIKey | GDZXWEGSUHRBMB-MDOVXXIYSA-N |
| XLogP | 5.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|