About N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine
N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine (PubChem CID 115318685) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 115318685 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)C1CCCCC1C(C)(C)C |
| InChI | InChI=1S/C14H30N2/c1-14(2,3)12-8-5-6-9-13(12)16(4)11-7-10-15/h12-13H,5-11,15H2,1-4H3 |
| InChIKey | VUWIECNLNLPGLV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine (CID 115318685) is N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine is CN(CCCN)C1CCCCC1C(C)(C)C.
What is the InChIKey of N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine?
The InChIKey is VUWIECNLNLPGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-14(2,3)12-8-5-6-9-13(12)16(4)11-7-10-15/h12-13H,5-11,15H2,1-4H3.
What are the key properties of N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine?
N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine has a molecular weight of 226.41 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-tert-butylcyclohexyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 115318685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).