C15H16N4O2 — CID 115319732
N-[2-(4-aminopyrazol-1-yl)ethyl]-5-methyl-1-benzofuran-2-carboxamide (PubChem CID 115319732) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-5-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-5-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 115319732 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-5-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)NCCn3cc(N)cn3)cc2c1 |
| InChI | InChI=1S/C15H16N4O2/c1-10-2-3-13-11(6-10)7-14(21-13)15(20)17-4-5-19-9-12(16)8-18-19/h2-3,6-9H,4-5,16H2,1H3,(H,17,20) |
| InChIKey | PRKDWRNONKTDKQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |