C10H18N4O4S — CID 115319868
ethyl 3-[2-(4-aminopyrazol-1-yl)ethylsulfamoyl]propanoate (PubChem CID 115319868) has the molecular formula C10H18N4O4S and a molecular weight of 290.34 g/mol. Its IUPAC name is ethyl 3-[2-(4-aminopyrazol-1-yl)ethylsulfamoyl]propanoate.
| Compound Name | ethyl 3-[2-(4-aminopyrazol-1-yl)ethylsulfamoyl]propanoate |
|---|---|
| PubChem CID | 115319868 |
| Molecular Formula | C10H18N4O4S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | ethyl 3-[2-(4-aminopyrazol-1-yl)ethylsulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)NCCn1cc(N)cn1 |
| InChI | InChI=1S/C10H18N4O4S/c1-2-18-10(15)3-6-19(16,17)13-4-5-14-8-9(11)7-12-14/h7-8,13H,2-6,11H2,1H3 |
| InChIKey | RCVISFLUMPCMDJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |