C15H22N4O2 — CID 115319952
3-[2-(4-aminopyrazol-1-yl)ethyl]-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 115319952) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[2-(4-aminopyrazol-1-yl)ethyl]-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[2-(4-aminopyrazol-1-yl)ethyl]-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 115319952 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[2-(4-aminopyrazol-1-yl)ethyl]-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | Nc1cnn(CCN2C(=O)CC3(CCCCC3)CC2=O)c1 |
| InChI | InChI=1S/C15H22N4O2/c16-12-10-17-18(11-12)6-7-19-13(20)8-15(9-14(19)21)4-2-1-3-5-15/h10-11H,1-9,16H2 |
| InChIKey | XXUGWTKNEOYGLO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|