C11H12F3N5 — CID 115319990
N-[2-(4-aminopyrazol-1-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 115319990) has the molecular formula C11H12F3N5 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115319990 |
| Molecular Formula | C11H12F3N5 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cnn(CCNc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C11H12F3N5/c12-11(13,14)8-1-2-10(17-5-8)16-3-4-19-7-9(15)6-18-19/h1-2,5-7H,3-4,15H2,(H,16,17) |
| InChIKey | NNGVXQFAFCULGU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |