C24H24F4N2O — CID 11532105
5-fluoro-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one (PubChem CID 11532105) has the molecular formula C24H24F4N2O and a molecular weight of 432.46 g/mol. Its IUPAC name is 5-fluoro-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 11532105 |
| Molecular Formula | C24H24F4N2O |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-fluoro-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1CCCCN1CC=C(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H24F4N2O/c25-19-7-8-22-21(15-19)20(23(31)29-22)6-1-2-11-30-12-9-16(10-13-30)17-4-3-5-18(14-17)24(26,27)28/h3-5,7-9,14-15,20H,1-2,6,10-13H2,(H,29,31) |
| InChIKey | AFFLRZAJRVFCHF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|