About 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione
2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione (PubChem CID 11532151) has the molecular formula C24H18O4S2
and a molecular weight of 434.54 g/mol. Its IUPAC name is 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione |
| PubChem CID | 11532151 |
| Molecular Formula | C24H18O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione |
| SMILES | COc1ccc(SC2=C(Sc3ccc(OC)cc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H18O4S2/c1-27-15-7-11-17(12-8-15)29-23-21(25)19-5-3-4-6-20(19)22(26)24(23)30-18-13-9-16(28-2)10-14-18/h3-14H,1-2H3 |
| InChIKey | QMQKTJBMOPHURH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione?
The IUPAC name of 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione (CID 11532151) is 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione.
What is the SMILES notation for 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione?
The canonical SMILES for 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione is COc1ccc(SC2=C(Sc3ccc(OC)cc3)C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione?
The InChIKey is QMQKTJBMOPHURH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O4S2/c1-27-15-7-11-17(12-8-15)29-23-21(25)19-5-3-4-6-20(19)22(26)24(23)30-18-13-9-16(28-2)10-14-18/h3-14H,1-2H3.
What are the key properties of 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione?
2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione has a molecular weight of 434.54 g/mol, XLogP of 5.88, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[(4-methoxyphenyl)sulfanyl]naphthalene-1,4-dione is sourced from PubChem (CID 11532151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).