C20H19ClF3N5O — CID 11532211
(2R,5S)-N-(6-chloro-3-pyridinyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide (PubChem CID 11532211) has the molecular formula C20H19ClF3N5O and a molecular weight of 437.85 g/mol. Its IUPAC name is (2R,5S)-N-(6-chloro-3-pyridinyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide.
| Compound Name | (2R,5S)-N-(6-chloro-3-pyridinyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 11532211 |
| Molecular Formula | C20H19ClF3N5O |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (2R,5S)-N-(6-chloro-3-pyridinyl)-4-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dimethylpiperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c(C(F)(F)F)c2)[C@@H](C)CN1C(=O)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H19ClF3N5O/c1-12-11-29(19(30)27-15-4-6-18(21)26-9-15)13(2)10-28(12)16-5-3-14(8-25)17(7-16)20(22,23)24/h3-7,9,12-13H,10-11H2,1-2H3,(H,27,30)/t12-,13+/m0/s1 |
| InChIKey | UJICGDSRLDKUIK-QWHCGFSZSA-N |
| XLogP | 4.76 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|