C13H13ClN4OS — CID 115322862
5-[[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 115322862) has the molecular formula C13H13ClN4OS and a molecular weight of 308.79 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 115322862 |
| Molecular Formula | C13H13ClN4OS |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-[[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | COc1ccc2nc(CCl)n(Cc3cnc(C)s3)c2n1 |
| InChI | InChI=1S/C13H13ClN4OS/c1-8-15-6-9(20-8)7-18-11(5-14)16-10-3-4-12(19-2)17-13(10)18/h3-4,6H,5,7H2,1-2H3 |
| InChIKey | MJGWJWYZPNAZQR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|