C18H13ClF2N2O3S2 — CID 11532326
4-chloro-N-(2,5-difluorophenyl)-N-[1-(2-formyl-1,3-thiazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 11532326) has the molecular formula C18H13ClF2N2O3S2 and a molecular weight of 442.90 g/mol. Its IUPAC name is 4-chloro-N-(2,5-difluorophenyl)-N-[1-(2-formyl-1,3-thiazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,5-difluorophenyl)-N-[1-(2-formyl-1,3-thiazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11532326 |
| Molecular Formula | C18H13ClF2N2O3S2 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 4-chloro-N-(2,5-difluorophenyl)-N-[1-(2-formyl-1,3-thiazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CC(c1cnc(C=O)s1)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClF2N2O3S2/c1-11(17-9-22-18(10-24)27-17)23(16-8-13(20)4-7-15(16)21)28(25,26)14-5-2-12(19)3-6-14/h2-11H,1H3 |
| InChIKey | MAPSXIKVEBGKPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|