C13H20N4O2 — CID 115324061
4,6-dimethyl-2-(morpholin-2-ylmethylamino)pyridine-3-carboxamide (PubChem CID 115324061) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4,6-dimethyl-2-(morpholin-2-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | 4,6-dimethyl-2-(morpholin-2-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115324061 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4,6-dimethyl-2-(morpholin-2-ylmethylamino)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(N)=O)c(NCC2CNCCO2)n1 |
| InChI | InChI=1S/C13H20N4O2/c1-8-5-9(2)17-13(11(8)12(14)18)16-7-10-6-15-3-4-19-10/h5,10,15H,3-4,6-7H2,1-2H3,(H2,14,18)(H,16,17) |
| InChIKey | DIAOKIMVMWWTSD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |