About CID 11532467
CID 11532467 (PubChem CID 11532467) has the molecular formula C21H43N3O2+
and a molecular weight of 369.59 g/mol.
Molecular Properties
| Compound Name | CID 11532467 |
| PubChem CID | 11532467 |
| Molecular Formula | C21H43N3O2+ |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.33 |
| IUPAC Name | — |
| SMILES | CC[N+](CC)(CC)CCCCCC(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C21H42N3O2/c1-8-24(9-2,10-3)15-13-11-12-14-19(25)22-18-16-20(4,5)23(26)21(6,7)17-18/h18H,8-17H2,1-7H3/p+1 |
| InChIKey | GMOOYWVPNJZOKR-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 11532467 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11532467?
The IUPAC name of CID 11532467 (CID 11532467) is not available.
What is the SMILES notation for CID 11532467?
The canonical SMILES for CID 11532467 is CC[N+](CC)(CC)CCCCCC(=O)NC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 11532467?
The InChIKey is GMOOYWVPNJZOKR-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H42N3O2/c1-8-24(9-2,10-3)15-13-11-12-14-19(25)22-18-16-20(4,5)23(26)21(6,7)17-18/h18H,8-17H2,1-7H3/p+1.
What are the key properties of CID 11532467?
CID 11532467 has a molecular weight of 369.59 g/mol, XLogP of 3.91, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11532467 is sourced from PubChem (CID 11532467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).