C11H19NO2 — CID 115325851
1-(5-methylhexyl)pyrrolidine-2,3-dione (PubChem CID 115325851) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(5-methylhexyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(5-methylhexyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 115325851 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-(5-methylhexyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)CCCCN1CCC(=O)C1=O |
| InChI | InChI=1S/C11H19NO2/c1-9(2)5-3-4-7-12-8-6-10(13)11(12)14/h9H,3-8H2,1-2H3 |
| InChIKey | ZKXJCWXQJPOFCA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|