C29H34N4O — CID 11532592
(1S,2R,13S,14S,17S,18S)-N-(2-cyano-3-methylphenyl)-2,18-dimethyl-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide (PubChem CID 11532592) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is (1S,2R,13S,14S,17S,18S)-N-(2-cyano-3-methylphenyl)-2,18-dimethyl-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide.
| Compound Name | (1S,2R,13S,14S,17S,18S)-N-(2-cyano-3-methylphenyl)-2,18-dimethyl-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide |
|---|---|
| PubChem CID | 11532592 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (1S,2R,13S,14S,17S,18S)-N-(2-cyano-3-methylphenyl)-2,18-dimethyl-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@H]2CC[C@H]3[C@@H]4CCC5n6ccnc6C=C[C@]5(C)[C@H]4CC[C@]23C)c1C#N |
| InChI | InChI=1S/C29H34N4O/c1-18-5-4-6-24(20(18)17-30)32-27(34)23-9-8-21-19-7-10-25-29(3,22(19)11-13-28(21,23)2)14-12-26-31-15-16-33(25)26/h4-6,12,14-16,19,21-23,25H,7-11,13H2,1-3H3,(H,32,34)/t19-,21-,22-,23+,25?,28-,29+/m0/s1 |
| InChIKey | BAFKPPCXTLRIBF-SLAKFKRVSA-N |
| XLogP | 6.13 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |