C24H42O6Si — CID 11532595
(1S,3R,8S,10R,12S,14R,15S,17R)-6,6-ditert-butyl-15-ethenyl-15,17-dimethyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol (PubChem CID 11532595) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is (1S,3R,8S,10R,12S,14R,15S,17R)-6,6-ditert-butyl-15-ethenyl-15,17-dimethyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol.
| Compound Name | (1S,3R,8S,10R,12S,14R,15S,17R)-6,6-ditert-butyl-15-ethenyl-15,17-dimethyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol |
|---|---|
| PubChem CID | 11532595 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (1S,3R,8S,10R,12S,14R,15S,17R)-6,6-ditert-butyl-15-ethenyl-15,17-dimethyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-14-ol |
| SMILES | C=C[C@]1(C)O[C@]2(C)C[C@@H]3O[C@@H]4CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]4C[C@H]3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H42O6Si/c1-10-23(8)19(25)12-20-24(9,30-23)13-17-15(28-20)11-16-18(27-17)14-26-31(29-16,21(2,3)4)22(5,6)7/h10,15-20,25H,1,11-14H2,2-9H3/t15-,16+,17+,18-,19-,20+,23+,24-/m1/s1 |
| InChIKey | NOZVDQOKYPGDBE-NSJANFJXSA-N |
| XLogP | 4.24 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|