C16H22ClFN2 — CID 115326562
2-(2-chloroethyl)-4-fluoro-1-(5-methylhexyl)benzimidazole (PubChem CID 115326562) has the molecular formula C16H22ClFN2 and a molecular weight of 296.82 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-fluoro-1-(5-methylhexyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-4-fluoro-1-(5-methylhexyl)benzimidazole |
|---|---|
| PubChem CID | 115326562 |
| Molecular Formula | C16H22ClFN2 |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-(2-chloroethyl)-4-fluoro-1-(5-methylhexyl)benzimidazole |
| SMILES | CC(C)CCCCn1c(CCCl)nc2c(F)cccc21 |
| InChI | InChI=1S/C16H22ClFN2/c1-12(2)6-3-4-11-20-14-8-5-7-13(18)16(14)19-15(20)9-10-17/h5,7-8,12H,3-4,6,9-11H2,1-2H3 |
| InChIKey | IFMPDJYJKRWHQT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|