C23H17F4N3O3 — CID 11532681
2-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 11532681) has the molecular formula C23H17F4N3O3 and a molecular weight of 459.40 g/mol. Its IUPAC name is 2-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | 2-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 11532681 |
| Molecular Formula | C23H17F4N3O3 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)C(F)F)c1)c1ccccc1Nc1cccc2c1CNC2=O |
| InChI | InChI=1S/C23H17F4N3O3/c24-22(25)23(26,27)33-14-6-3-5-13(11-14)29-21(32)16-7-1-2-9-18(16)30-19-10-4-8-15-17(19)12-28-20(15)31/h1-11,22,30H,12H2,(H,28,31)(H,29,32) |
| InChIKey | FLQJLRKWHOQDDX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|