C14H26N4O — CID 115326890
5-tert-butyl-N-(5-methylhexyl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 115326890) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 5-tert-butyl-N-(5-methylhexyl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(5-methylhexyl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 115326890 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 5-tert-butyl-N-(5-methylhexyl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)CCCCNC(=O)c1n[nH]c(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H26N4O/c1-10(2)8-6-7-9-15-12(19)11-16-13(18-17-11)14(3,4)5/h10H,6-9H2,1-5H3,(H,15,19)(H,16,17,18) |
| InChIKey | DEAMXOVKPLIVTR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|