About 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane
9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane (PubChem CID 115327089) has the molecular formula C18H36N2
and a molecular weight of 280.50 g/mol. Its IUPAC name is 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane |
| PubChem CID | 115327089 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane |
| SMILES | CC(C)CCCCN1CC2(CCCC2)NCC1C(C)C |
| InChI | InChI=1S/C18H36N2/c1-15(2)9-5-8-12-20-14-18(10-6-7-11-18)19-13-17(20)16(3)4/h15-17,19H,5-14H2,1-4H3 |
| InChIKey | JQMVJVKDIHORCQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane?
The IUPAC name of 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane (CID 115327089) is 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane is CC(C)CCCCN1CC2(CCCC2)NCC1C(C)C.
What is the InChIKey of 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane?
The InChIKey is JQMVJVKDIHORCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2/c1-15(2)9-5-8-12-20-14-18(10-6-7-11-18)19-13-17(20)16(3)4/h15-17,19H,5-14H2,1-4H3.
What are the key properties of 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane?
9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane has a molecular weight of 280.50 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5-methylhexyl)-8-propan-2-yl-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 115327089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).