C21H22Cl2N6O2 — CID 11532717
8-[1-[(2,5-dichlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 11532717) has the molecular formula C21H22Cl2N6O2 and a molecular weight of 461.35 g/mol. Its IUPAC name is 8-[1-[(2,5-dichlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[1-[(2,5-dichlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11532717 |
| Molecular Formula | C21H22Cl2N6O2 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 8-[1-[(2,5-dichlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cnn(Cc4cc(Cl)ccc4Cl)c3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C21H22Cl2N6O2/c1-3-7-28-19-17(20(30)29(8-4-2)21(28)31)25-18(26-19)14-10-24-27(12-14)11-13-9-15(22)5-6-16(13)23/h5-6,9-10,12H,3-4,7-8,11H2,1-2H3,(H,25,26) |
| InChIKey | ZTLBDXCSPFQWAK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |